methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate

C8H14O4S — CID 102192460

IUPACmethyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate
SMILESCOC(=O)[C@H]1[C@H](C)CCCS1(=O)=O
InChIInChI=1S/C8H14O4S/c1-6-4-3-5-13(10,11)7(6)8(9)12-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1
InChIKeyDBUPAKVQZJLUAQ-RNFRBKRXSA-N
MW206.26 g/mol
LogP0.37
Rot. Bonds1

About methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate

methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate (PubChem CID 102192460) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate.

Molecular Properties

Compound Namemethyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate
PubChem CID102192460
Molecular FormulaC8H14O4S
Molecular Weight206.26 g/mol
Exact Mass206.06
IUPAC Namemethyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate
SMILESCOC(=O)[C@H]1[C@H](C)CCCS1(=O)=O
InChIInChI=1S/C8H14O4S/c1-6-4-3-5-13(10,11)7(6)8(9)12-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1
InChIKeyDBUPAKVQZJLUAQ-RNFRBKRXSA-N
XLogP0.37
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.26
LogP ≤ 50.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate?
The IUPAC name of methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate (CID 102192460) is methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate.
What is the SMILES notation for methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate?
The canonical SMILES for methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate is COC(=O)[C@H]1[C@H](C)CCCS1(=O)=O.
What is the InChIKey of methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate?
The InChIKey is DBUPAKVQZJLUAQ-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H14O4S/c1-6-4-3-5-13(10,11)7(6)8(9)12-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate?
methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate has a molecular weight of 206.26 g/mol, XLogP of 0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3R)-3-methyl-1,1-dioxothiane-2-carboxylate is sourced from PubChem (CID 102192460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).