C14H20O3 — CID 102192551
(3S)-3-hydroxy-8-(hydroxymethyl)-5-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-6-one (PubChem CID 102192551) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3S)-3-hydroxy-8-(hydroxymethyl)-5-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-6-one.
| Compound Name | (3S)-3-hydroxy-8-(hydroxymethyl)-5-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-6-one |
|---|---|
| PubChem CID | 102192551 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3S)-3-hydroxy-8-(hydroxymethyl)-5-propan-2-ylidene-1,2,3,3a,4,8a-hexahydroazulen-6-one |
| SMILES | CC(C)=C1CC2C(CC[C@@H]2O)C(CO)=CC1=O |
| InChI | InChI=1S/C14H20O3/c1-8(2)11-6-12-10(3-4-13(12)16)9(7-15)5-14(11)17/h5,10,12-13,15-16H,3-4,6-7H2,1-2H3/t10?,12?,13-/m0/s1 |
| InChIKey | TZYSTXNPBRXLKM-GDKBPFBDSA-N |
| XLogP | 1.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|