About CID 102192763
CID 102192763 (PubChem CID 102192763) has the molecular formula C23H38O6
and a molecular weight of 410.55 g/mol.
Molecular Properties
| Compound Name | CID 102192763 |
| PubChem CID | 102192763 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1CC2(CCC3(CCCC4C(C)(C)C(OC(C)=O)CCC43C)O2)[C@@H](OC)O1 |
| InChI | InChI=1S/C23H38O6/c1-15(24)27-17-9-11-21(4)16(20(17,2)3)8-7-10-23(21)13-12-22(29-23)14-18(25-5)28-19(22)26-6/h16-19H,7-14H2,1-6H3/t16?,17?,18-,19-,21?,22?,23?/m0/s1 |
| InChIKey | HUSWIFOINKVFAU-WHSOSHKASA-N |
| XLogP | 4.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 102192763 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102192763?
The IUPAC name of CID 102192763 (CID 102192763) is not available.
What is the SMILES notation for CID 102192763?
The canonical SMILES for CID 102192763 is CO[C@@H]1CC2(CCC3(CCCC4C(C)(C)C(OC(C)=O)CCC43C)O2)[C@@H](OC)O1.
What is the InChIKey of CID 102192763?
The InChIKey is HUSWIFOINKVFAU-WHSOSHKASA-N. The full InChI is InChI=1S/C23H38O6/c1-15(24)27-17-9-11-21(4)16(20(17,2)3)8-7-10-23(21)13-12-22(29-23)14-18(25-5)28-19(22)26-6/h16-19H,7-14H2,1-6H3/t16?,17?,18-,19-,21?,22?,23?/m0/s1.
What are the key properties of CID 102192763?
CID 102192763 has a molecular weight of 410.55 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102192763 is sourced from PubChem (CID 102192763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).