C14H23IO2 — CID 102192998
(4S,6S)-6-(1-ethoxy-2-iodoethoxy)-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 102192998) has the molecular formula C14H23IO2 and a molecular weight of 350.24 g/mol. Its IUPAC name is (4S,6S)-6-(1-ethoxy-2-iodoethoxy)-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4S,6S)-6-(1-ethoxy-2-iodoethoxy)-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 102192998 |
| Molecular Formula | C14H23IO2 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (4S,6S)-6-(1-ethoxy-2-iodoethoxy)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)[C@H]1CC=C(C)[C@@H](OC(CI)OCC)C1 |
| InChI | InChI=1S/C14H23IO2/c1-5-16-14(9-15)17-13-8-12(10(2)3)7-6-11(13)4/h6,12-14H,2,5,7-9H2,1,3-4H3/t12-,13-,14?/m0/s1 |
| InChIKey | UPKLYDCFASGDIV-RFHHWMCGSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|