About CID 102193131
CID 102193131 (PubChem CID 102193131) has the molecular formula C15H27N2
and a molecular weight of 235.39 g/mol.
Molecular Properties
| Compound Name | CID 102193131 |
| PubChem CID | 102193131 |
| Molecular Formula | C15H27N2 |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.22 |
| IUPAC Name | — |
| SMILES | [CH]1N(C2CCCCC2)CCN1C1CCCCC1 |
| InChI | InChI=1S/C15H27N2/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15/h13-15H,1-12H2 |
| InChIKey | KYEKDXZLDFZVSJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102193131 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102193131?
The IUPAC name of CID 102193131 (CID 102193131) is not available.
What is the SMILES notation for CID 102193131?
The canonical SMILES for CID 102193131 is [CH]1N(C2CCCCC2)CCN1C1CCCCC1.
What is the InChIKey of CID 102193131?
The InChIKey is KYEKDXZLDFZVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N2/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15/h13-15H,1-12H2.
What are the key properties of CID 102193131?
CID 102193131 has a molecular weight of 235.39 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102193131 is sourced from PubChem (CID 102193131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).