About CID 102193133
CID 102193133 (PubChem CID 102193133) has the molecular formula C19H27N2
and a molecular weight of 283.44 g/mol.
Molecular Properties
| Compound Name | CID 102193133 |
| PubChem CID | 102193133 |
| Molecular Formula | C19H27N2 |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | — |
| SMILES | [CH]1N(C2CCCCC2)c2ccccc2N1C1CCCCC1 |
| InChI | InChI=1S/C19H27N2/c1-3-9-16(10-4-1)20-15-21(17-11-5-2-6-12-17)19-14-8-7-13-18(19)20/h7-8,13-17H,1-6,9-12H2 |
| InChIKey | OUONZCAAMJXBCU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102193133 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102193133?
The IUPAC name of CID 102193133 (CID 102193133) is not available.
What is the SMILES notation for CID 102193133?
The canonical SMILES for CID 102193133 is [CH]1N(C2CCCCC2)c2ccccc2N1C1CCCCC1.
What is the InChIKey of CID 102193133?
The InChIKey is OUONZCAAMJXBCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N2/c1-3-9-16(10-4-1)20-15-21(17-11-5-2-6-12-17)19-14-8-7-13-18(19)20/h7-8,13-17H,1-6,9-12H2.
What are the key properties of CID 102193133?
CID 102193133 has a molecular weight of 283.44 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102193133 is sourced from PubChem (CID 102193133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).