C12H16O3 — CID 102193143
(1S,2R,4S,7R,8R)-3-methoxy-10,12-dioxatetracyclo[6.5.0.02,4.03,7]tridec-5-ene (PubChem CID 102193143) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1S,2R,4S,7R,8R)-3-methoxy-10,12-dioxatetracyclo[6.5.0.02,4.03,7]tridec-5-ene.
| Compound Name | (1S,2R,4S,7R,8R)-3-methoxy-10,12-dioxatetracyclo[6.5.0.02,4.03,7]tridec-5-ene |
|---|---|
| PubChem CID | 102193143 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1S,2R,4S,7R,8R)-3-methoxy-10,12-dioxatetracyclo[6.5.0.02,4.03,7]tridec-5-ene |
| SMILES | COC12C3C=C[C@@H]1[C@@H]1COCOC[C@@H]1[C@H]32 |
| InChI | InChI=1S/C12H16O3/c1-13-12-9-2-3-10(12)11(12)8-5-15-6-14-4-7(8)9/h2-3,7-11H,4-6H2,1H3/t7-,8+,9-,10?,11-,12?/m1/s1 |
| InChIKey | MFJVVKHZRMSFFN-CHRQYUIFSA-N |
| XLogP | 1.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|