C21H37NO3 — CID 102193329
tert-butyl 2-[(1Z,3E)-undeca-1,3-dienoxy]piperidine-1-carboxylate (PubChem CID 102193329) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is tert-butyl 2-[(1Z,3E)-undeca-1,3-dienoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(1Z,3E)-undeca-1,3-dienoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102193329 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | tert-butyl 2-[(1Z,3E)-undeca-1,3-dienoxy]piperidine-1-carboxylate |
| SMILES | CCCCCCC/C=C/C=C\OC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO3/c1-5-6-7-8-9-10-11-12-15-18-24-19-16-13-14-17-22(19)20(23)25-21(2,3)4/h11-12,15,18-19H,5-10,13-14,16-17H2,1-4H3/b12-11+,18-15- |
| InChIKey | AGLDCKSYLWAQOS-YIKZKUGMSA-N |
| XLogP | 6.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|