About tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate
tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate (PubChem CID 102193334) has the molecular formula C21H37NO3
and a molecular weight of 351.53 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate |
| PubChem CID | 102193334 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate |
| SMILES | CCCCCCC/C=C/[C@H](C=O)[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO3/c1-5-6-7-8-9-10-11-14-18(17-23)19-15-12-13-16-22(19)20(24)25-21(2,3)4/h11,14,17-19H,5-10,12-13,15-16H2,1-4H3/b14-11+/t18-,19-/m1/s1 |
| InChIKey | GMQRFRCCPMDQTE-UPQQSIJHSA-N |
| XLogP | 5.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate (CID 102193334) is tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate is CCCCCCC/C=C/[C@H](C=O)[C@H]1CCCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate?
The InChIKey is GMQRFRCCPMDQTE-UPQQSIJHSA-N. The full InChI is InChI=1S/C21H37NO3/c1-5-6-7-8-9-10-11-14-18(17-23)19-15-12-13-16-22(19)20(24)25-21(2,3)4/h11,14,17-19H,5-10,12-13,15-16H2,1-4H3/b14-11+/t18-,19-/m1/s1.
What are the key properties of tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate?
tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate has a molecular weight of 351.53 g/mol, XLogP of 5.51, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-[(E,2S)-1-oxoundec-3-en-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 102193334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).