About but-3-en-2-one;ethene
but-3-en-2-one;ethene (PubChem CID 10219388) has the molecular formula C6H10O
and a molecular weight of 98.15 g/mol. Its IUPAC name is but-3-en-2-one;ethene.
Molecular Properties
| Compound Name | but-3-en-2-one;ethene |
| PubChem CID | 10219388 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | but-3-en-2-one;ethene |
| SMILES | C=C.C=CC(C)=O |
| InChI | InChI=1S/C4H6O.C2H4/c1-3-4(2)5;1-2/h3H,1H2,2H3;1-2H2 |
| InChIKey | DRKYBGIWEPKRHD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;ethene?
The IUPAC name of but-3-en-2-one;ethene (CID 10219388) is but-3-en-2-one;ethene.
What is the SMILES notation for but-3-en-2-one;ethene?
The canonical SMILES for but-3-en-2-one;ethene is C=C.C=CC(C)=O.
What is the InChIKey of but-3-en-2-one;ethene?
The InChIKey is DRKYBGIWEPKRHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.C2H4/c1-3-4(2)5;1-2/h3H,1H2,2H3;1-2H2.
What are the key properties of but-3-en-2-one;ethene?
but-3-en-2-one;ethene has a molecular weight of 98.15 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;ethene is sourced from PubChem (CID 10219388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).