About 1H-imidazol-2-ylurea
1H-imidazol-2-ylurea (PubChem CID 10219434) has the molecular formula C4H6N4O
and a molecular weight of 126.12 g/mol. Its IUPAC name is 1H-imidazol-2-ylurea.
Molecular Properties
| Compound Name | 1H-imidazol-2-ylurea |
| PubChem CID | 10219434 |
| Molecular Formula | C4H6N4O |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | 1H-imidazol-2-ylurea |
| SMILES | NC(=O)Nc1ncc[nH]1 |
| InChI | InChI=1S/C4H6N4O/c5-3(9)8-4-6-1-2-7-4/h1-2H,(H4,5,6,7,8,9) |
| InChIKey | QYEMLLMAPAWTPT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-imidazol-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-ylurea?
The IUPAC name of 1H-imidazol-2-ylurea (CID 10219434) is 1H-imidazol-2-ylurea.
What is the SMILES notation for 1H-imidazol-2-ylurea?
The canonical SMILES for 1H-imidazol-2-ylurea is NC(=O)Nc1ncc[nH]1.
What is the InChIKey of 1H-imidazol-2-ylurea?
The InChIKey is QYEMLLMAPAWTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O/c5-3(9)8-4-6-1-2-7-4/h1-2H,(H4,5,6,7,8,9).
What are the key properties of 1H-imidazol-2-ylurea?
1H-imidazol-2-ylurea has a molecular weight of 126.12 g/mol, XLogP of -0.10, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-ylurea is sourced from PubChem (CID 10219434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).