C22H8F4O2P2S4 — CID 102194440
7-[2,3,5,6-tetrafluoro-4-(7-oxo-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenyl]-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide (PubChem CID 102194440) has the molecular formula C22H8F4O2P2S4 and a molecular weight of 570.51 g/mol. Its IUPAC name is 7-[2,3,5,6-tetrafluoro-4-(7-oxo-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenyl]-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide.
| Compound Name | 7-[2,3,5,6-tetrafluoro-4-(7-oxo-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenyl]-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide |
|---|---|
| PubChem CID | 102194440 |
| Molecular Formula | C22H8F4O2P2S4 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 569.88 |
| IUPAC Name | 7-[2,3,5,6-tetrafluoro-4-(7-oxo-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-yl)phenyl]-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7-oxide |
| SMILES | O=P1(c2c(F)c(F)c(P3(=O)c4ccsc4-c4sccc43)c(F)c2F)c2ccsc2-c2sccc21 |
| InChI | InChI=1S/C22H8F4O2P2S4/c23-13-15(25)18(30(28)11-3-7-33-21(11)22-12(30)4-8-34-22)16(26)14(24)17(13)29(27)9-1-5-31-19(9)20-10(29)2-6-32-20/h1-8H |
| InChIKey | VIJMHQICELJQRZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|