C20H16N6O4S2 — CID 102194897
1-N,3-N-bis[(3-hydroxy-2-pyridinyl)carbamothioyl]benzene-1,3-dicarboxamide (PubChem CID 102194897) has the molecular formula C20H16N6O4S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 1-N,3-N-bis[(3-hydroxy-2-pyridinyl)carbamothioyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[(3-hydroxy-2-pyridinyl)carbamothioyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 102194897 |
| Molecular Formula | C20H16N6O4S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 1-N,3-N-bis[(3-hydroxy-2-pyridinyl)carbamothioyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(NC(=S)Nc1ncccc1O)c1cccc(C(=O)NC(=S)Nc2ncccc2O)c1 |
| InChI | InChI=1S/C20H16N6O4S2/c27-13-6-2-8-21-15(13)23-19(31)25-17(29)11-4-1-5-12(10-11)18(30)26-20(32)24-16-14(28)7-3-9-22-16/h1-10,27-28H,(H2,21,23,25,29,31)(H2,22,24,26,30,32) |
| InChIKey | CODJEPVEMPGONG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|