About CID 102194903
CID 102194903 (PubChem CID 102194903) has the molecular formula C72H92B4O20
and a molecular weight of 1320.76 g/mol.
Molecular Properties
| Compound Name | CID 102194903 |
| PubChem CID | 102194903 |
| Molecular Formula | C72H92B4O20 |
| Molecular Weight | 1320.76 g/mol |
| Exact Mass | 1320.66 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CC3C4OB5OC4C(C)(C)C3CC2C2OB(OC21)c1ccc2c(c1)OCCOCCOc1cc(ccc1OCCOCCO2)B1OC2C3CC4C(CC3C(C)(C)C2O1)C1OB(OC1C4(C)C)c1ccc2c(c1)OCCOCCOc1cc5ccc1OCCOCCO2 |
| InChI | InChI=1S/C72H92B4O20/c1-69(2)49-37-46-50-38-45(49)61-65(69)93-73(89-61)41-9-13-53-57(33-41)85-29-21-79-22-31-87-59-35-43(11-15-55(59)83-27-18-77-17-25-81-53)75-91-63-47-39-52-48(40-51(47)71(5,6)67(63)95-75)64-68(72(52,7)8)96-76(92-64)44-12-16-56-60(36-44)88-32-24-80-23-30-86-58-34-42(74-90-62(46)66(94-74)70(50,3)4)10-14-54(58)82-26-19-78-20-28-84-56/h9-16,33-36,45-52,61-68H,17-32,37-40H2,1-8H3 |
| InChIKey | GTBUAJDIEKYDJL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 184.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | |
| Heavy Atoms | 96 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1320.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 102194903 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102194903?
The IUPAC name of CID 102194903 (CID 102194903) is not available.
What is the SMILES notation for CID 102194903?
The canonical SMILES for CID 102194903 is CC1(C)C2CC3C4OB5OC4C(C)(C)C3CC2C2OB(OC21)c1ccc2c(c1)OCCOCCOc1cc(ccc1OCCOCCO2)B1OC2C3CC4C(CC3C(C)(C)C2O1)C1OB(OC1C4(C)C)c1ccc2c(c1)OCCOCCOc1cc5ccc1OCCOCCO2.
What is the InChIKey of CID 102194903?
The InChIKey is GTBUAJDIEKYDJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C72H92B4O20/c1-69(2)49-37-46-50-38-45(49)61-65(69)93-73(89-61)41-9-13-53-57(33-41)85-29-21-79-22-31-87-59-35-43(11-15-55(59)83-27-18-77-17-25-81-53)75-91-63-47-39-52-48(40-51(47)71(5,6)67(63)95-75)64-68(72(52,7)8)96-76(92-64)44-12-16-56-60(36-44)88-32-24-80-23-30-86-58-34-42(74-90-62(46)66(94-74)70(50,3)4)10-14-54(58)82-26-19-78-20-28-84-56/h9-16,33-36,45-52,61-68H,17-32,37-40H2,1-8H3.
What are the key properties of CID 102194903?
CID 102194903 has a molecular weight of 1320.76 g/mol, XLogP of 6.52, 0 rotatable bonds, 0 hydrogen bond donors, and 20 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102194903 is sourced from PubChem (CID 102194903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).