C9H9NO2 — CID 10219589
(3R,4S)-3-hydroxy-4-phenylazetidin-2-one (PubChem CID 10219589) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is (3R,4S)-3-hydroxy-4-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-hydroxy-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 10219589 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (3R,4S)-3-hydroxy-4-phenylazetidin-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C9H9NO2/c11-8-7(10-9(8)12)6-4-2-1-3-5-6/h1-5,7-8,11H,(H,10,12)/t7-,8+/m0/s1 |
| InChIKey | FBZSDKXFQUKDLD-JGVFFNPUSA-N |
| XLogP | 0.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |