About 1-tert-butyl-1,2,3,3-tetramethylguanidine
1-tert-butyl-1,2,3,3-tetramethylguanidine (PubChem CID 10219612) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 1-tert-butyl-1,2,3,3-tetramethylguanidine.
Molecular Properties
| Compound Name | 1-tert-butyl-1,2,3,3-tetramethylguanidine |
| PubChem CID | 10219612 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1-tert-butyl-1,2,3,3-tetramethylguanidine |
| SMILES | C/N=C(\N(C)C)N(C)C(C)(C)C |
| InChI | InChI=1S/C9H21N3/c1-9(2,3)12(7)8(10-4)11(5)6/h1-7H3/b10-8+ |
| InChIKey | JJIXSFJJWJOGSH-CSKARUKUSA-N |
| XLogP | 1.26 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-1,2,3,3-tetramethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1,2,3,3-tetramethylguanidine?
The IUPAC name of 1-tert-butyl-1,2,3,3-tetramethylguanidine (CID 10219612) is 1-tert-butyl-1,2,3,3-tetramethylguanidine.
What is the SMILES notation for 1-tert-butyl-1,2,3,3-tetramethylguanidine?
The canonical SMILES for 1-tert-butyl-1,2,3,3-tetramethylguanidine is C/N=C(\N(C)C)N(C)C(C)(C)C.
What is the InChIKey of 1-tert-butyl-1,2,3,3-tetramethylguanidine?
The InChIKey is JJIXSFJJWJOGSH-CSKARUKUSA-N. The full InChI is InChI=1S/C9H21N3/c1-9(2,3)12(7)8(10-4)11(5)6/h1-7H3/b10-8+.
What are the key properties of 1-tert-butyl-1,2,3,3-tetramethylguanidine?
1-tert-butyl-1,2,3,3-tetramethylguanidine has a molecular weight of 171.29 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1,2,3,3-tetramethylguanidine is sourced from PubChem (CID 10219612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).