About (3,4-dimethylphenyl) N,N-diethylcarbamate
(3,4-dimethylphenyl) N,N-diethylcarbamate (PubChem CID 102196145) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is (3,4-dimethylphenyl) N,N-diethylcarbamate.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl) N,N-diethylcarbamate |
| PubChem CID | 102196145 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3,4-dimethylphenyl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-5-14(6-2)13(15)16-12-8-7-10(3)11(4)9-12/h7-9H,5-6H2,1-4H3 |
| InChIKey | DEDQHYMAWVRDSR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,4-dimethylphenyl) N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl) N,N-diethylcarbamate?
The IUPAC name of (3,4-dimethylphenyl) N,N-diethylcarbamate (CID 102196145) is (3,4-dimethylphenyl) N,N-diethylcarbamate.
What is the SMILES notation for (3,4-dimethylphenyl) N,N-diethylcarbamate?
The canonical SMILES for (3,4-dimethylphenyl) N,N-diethylcarbamate is CCN(CC)C(=O)Oc1ccc(C)c(C)c1.
What is the InChIKey of (3,4-dimethylphenyl) N,N-diethylcarbamate?
The InChIKey is DEDQHYMAWVRDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-5-14(6-2)13(15)16-12-8-7-10(3)11(4)9-12/h7-9H,5-6H2,1-4H3.
What are the key properties of (3,4-dimethylphenyl) N,N-diethylcarbamate?
(3,4-dimethylphenyl) N,N-diethylcarbamate has a molecular weight of 221.30 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl) N,N-diethylcarbamate is sourced from PubChem (CID 102196145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).