C17H34O2Si — CID 102196549
cis-(1R,4R)-2-propan-2-ylidene-4-tri(propan-2-yl)silyloxycyclopentan-1-ol (PubChem CID 102196549) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is cis-(1R,4R)-2-propan-2-ylidene-4-tri(propan-2-yl)silyloxycyclopentan-1-ol.
| Compound Name | cis-(1R,4R)-2-propan-2-ylidene-4-tri(propan-2-yl)silyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 102196549 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | cis-(1R,4R)-2-propan-2-ylidene-4-tri(propan-2-yl)silyloxycyclopentan-1-ol |
| SMILES | CC(C)=C1C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@H]1O |
| InChI | InChI=1S/C17H34O2Si/c1-11(2)16-9-15(10-17(16)18)19-20(12(3)4,13(5)6)14(7)8/h12-15,17-18H,9-10H2,1-8H3/t15-,17-/m1/s1 |
| InChIKey | FFGKEGWXRZFNAV-NVXWUHKLSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|