About 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine
7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 10219718) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Analyze 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 10219718) is 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine is CC1COc2c(ccc(F)c2F)N1.
What is the InChIKey of 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is BVHSAZFNVBBGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c1-5-4-13-9-7(12-5)3-2-6(10)8(9)11/h2-3,5,12H,4H2,1H3.
What are the key properties of 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 185.17 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 10219718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).