About Ferrocene
Ferrocene (PubChem CID 10219726) has the molecular formula C10H10Fe
and a molecular weight of 186.03 g/mol.
Molecular Properties
| Compound Name | Ferrocene |
| PubChem CID | 10219726 |
| Molecular Formula | C10H10Fe |
| Molecular Weight | 186.03 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | — |
| SMILES | [CH]1C=CC=C1.[CH]1C=CC=C1.[Fe] |
| InChI | InChI=1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | DFRHTHSZMBROSH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.03 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Ferrocene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ferrocene?
The IUPAC name of Ferrocene (CID 10219726) is not available.
What is the SMILES notation for Ferrocene?
The canonical SMILES for Ferrocene is [CH]1C=CC=C1.[CH]1C=CC=C1.[Fe].
What is the InChIKey of Ferrocene?
The InChIKey is DFRHTHSZMBROSH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;.
What are the key properties of Ferrocene?
Ferrocene has a molecular weight of 186.03 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Ferrocene is sourced from PubChem (CID 10219726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).