C26H16N4O2 — CID 102197263
2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]benzoic acid (PubChem CID 102197263) has the molecular formula C26H16N4O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]benzoic acid.
| Compound Name | 2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 102197263 |
| Molecular Formula | C26H16N4O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccccc1-c1nc2c3cccnc3c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C26H16N4O2/c31-26(32)18-10-4-2-8-16(18)15-7-1-3-9-17(15)25-29-23-19-11-5-13-27-21(19)22-20(24(23)30-25)12-6-14-28-22/h1-14H,(H,29,30)(H,31,32) |
| InChIKey | BRJPEMKOZOCIPL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|