C12H15NO — CID 10219748
11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 10219748) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | 11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 10219748 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 11-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | Oc1ccc2c(c1)C1CNCC(C2)C1 |
| InChI | InChI=1S/C12H15NO/c14-11-2-1-9-3-8-4-10(7-13-6-8)12(9)5-11/h1-2,5,8,10,13-14H,3-4,6-7H2 |
| InChIKey | DICOOVAUGLVWQN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |