C6HO6- — CID 102197482
2,3,4,5,6-pentaoxocyclohexan-1-olate (PubChem CID 102197482) has the molecular formula C6HO6- and a molecular weight of 169.07 g/mol. Its IUPAC name is 2,3,4,5,6-pentaoxocyclohexan-1-olate.
| Compound Name | 2,3,4,5,6-pentaoxocyclohexan-1-olate |
|---|---|
| PubChem CID | 102197482 |
| Molecular Formula | C6HO6- |
| Molecular Weight | 169.07 g/mol |
| Exact Mass | 168.98 |
| IUPAC Name | 2,3,4,5,6-pentaoxocyclohexan-1-olate |
| SMILES | O=C1C(=O)C(=O)C([O-])C(=O)C1=O |
| InChI | InChI=1S/C6HO6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1H/q-1 |
| InChIKey | SZGURPMMBSGCMD-UHFFFAOYSA-N |
| XLogP | -3.43 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.07 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|