C23H15N5O4 — CID 102197601
2,4-diamino-5-(1-hydroxynaphthalen-2-yl)-7-nitro-5H-chromeno[2,3-b]pyridine-3-carbonitrile (PubChem CID 102197601) has the molecular formula C23H15N5O4 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2,4-diamino-5-(1-hydroxynaphthalen-2-yl)-7-nitro-5H-chromeno[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 2,4-diamino-5-(1-hydroxynaphthalen-2-yl)-7-nitro-5H-chromeno[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102197601 |
| Molecular Formula | C23H15N5O4 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2,4-diamino-5-(1-hydroxynaphthalen-2-yl)-7-nitro-5H-chromeno[2,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1N)C(c1ccc3ccccc3c1O)c1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C23H15N5O4/c24-10-16-20(25)19-18(14-7-5-11-3-1-2-4-13(11)21(14)29)15-9-12(28(30)31)6-8-17(15)32-23(19)27-22(16)26/h1-9,18,29H,(H4,25,26,27) |
| InChIKey | GFCLHTUAFVNVRZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 161.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|