C17H20BrNO3S — CID 102197667
N-[(1R,2R)-2-bromo-1-ethoxy-2-phenylethyl]-N-methylbenzenesulfonamide (PubChem CID 102197667) has the molecular formula C17H20BrNO3S and a molecular weight of 398.32 g/mol. Its IUPAC name is N-[(1R,2R)-2-bromo-1-ethoxy-2-phenylethyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-bromo-1-ethoxy-2-phenylethyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102197667 |
| Molecular Formula | C17H20BrNO3S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-[(1R,2R)-2-bromo-1-ethoxy-2-phenylethyl]-N-methylbenzenesulfonamide |
| SMILES | CCO[C@H]([C@H](Br)c1ccccc1)N(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20BrNO3S/c1-3-22-17(16(18)14-10-6-4-7-11-14)19(2)23(20,21)15-12-8-5-9-13-15/h4-13,16-17H,3H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | RYKIPYVRDAXBDC-IAGOWNOFSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|