About 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole
2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole (PubChem CID 10219857) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole |
| PubChem CID | 10219857 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole |
| SMILES | CN1c2ccccc2CC1C1=NCCN1 |
| InChI | InChI=1S/C12H15N3/c1-15-10-5-3-2-4-9(10)8-11(15)12-13-6-7-14-12/h2-5,11H,6-8H2,1H3,(H,13,14) |
| InChIKey | IDOHPYFJXXCMEX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole (CID 10219857) is 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole is CN1c2ccccc2CC1C1=NCCN1.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole?
The InChIKey is IDOHPYFJXXCMEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-15-10-5-3-2-4-9(10)8-11(15)12-13-6-7-14-12/h2-5,11H,6-8H2,1H3,(H,13,14).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole?
2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole has a molecular weight of 201.27 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-yl)-1-methyl-2,3-dihydroindole is sourced from PubChem (CID 10219857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).