About (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide
(E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide (PubChem CID 10219859) has the molecular formula C8H14N2O4
and a molecular weight of 202.21 g/mol. Its IUPAC name is (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide.
Molecular Properties
| Compound Name | (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide |
| PubChem CID | 10219859 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide |
| SMILES | O=C(/C=C/C(=O)NCCO)NCCO |
| InChI | InChI=1S/C8H14N2O4/c11-5-3-9-7(13)1-2-8(14)10-4-6-12/h1-2,11-12H,3-6H2,(H,9,13)(H,10,14)/b2-1+ |
| InChIKey | UHTRANZKKBMVCM-OWOJBTEDSA-N |
| XLogP | -2.24 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide?
The IUPAC name of (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide (CID 10219859) is (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide.
What is the SMILES notation for (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide?
The canonical SMILES for (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide is O=C(/C=C/C(=O)NCCO)NCCO.
What is the InChIKey of (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide?
The InChIKey is UHTRANZKKBMVCM-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H14N2O4/c11-5-3-9-7(13)1-2-8(14)10-4-6-12/h1-2,11-12H,3-6H2,(H,9,13)(H,10,14)/b2-1+.
What are the key properties of (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide?
(E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide has a molecular weight of 202.21 g/mol, XLogP of -2.24, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-bis(2-hydroxyethyl)but-2-enediamide is sourced from PubChem (CID 10219859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).