C11H10N2O2 — CID 10219860
7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-5,8-dione (PubChem CID 10219860) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-5,8-dione.
| Compound Name | 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-5,8-dione |
|---|---|
| PubChem CID | 10219860 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazole-5,8-dione |
| SMILES | CC1=CC(=O)c2nc3n(c2C1=O)CCC3 |
| InChI | InChI=1S/C11H10N2O2/c1-6-5-7(14)9-10(11(6)15)13-4-2-3-8(13)12-9/h5H,2-4H2,1H3 |
| InChIKey | NTMDBNGFEQBNJD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|