C21H24N2 — CID 102198802
(4R,5R)-2-cyclohexyl-4,5-diphenyl-4,5-dihydro-1H-imidazole (PubChem CID 102198802) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is (4R,5R)-2-cyclohexyl-4,5-diphenyl-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5R)-2-cyclohexyl-4,5-diphenyl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 102198802 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (4R,5R)-2-cyclohexyl-4,5-diphenyl-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc([C@H]2N=C(C3CCCCC3)N[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23-21(22-19)18-14-8-3-9-15-18/h1-2,4-7,10-13,18-20H,3,8-9,14-15H2,(H,22,23)/t19-,20-/m1/s1 |
| InChIKey | MBOGKJJELWQGHB-WOJBJXKFSA-N |
| XLogP | 5.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |