About 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole
5-(7,7-dimethyloct-3-ynyl)-1H-imidazole (PubChem CID 10219888) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole.
Molecular Properties
| Compound Name | 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole |
| PubChem CID | 10219888 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole |
| SMILES | CC(C)(C)CCC#CCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H20N2/c1-13(2,3)9-7-5-4-6-8-12-10-14-11-15-12/h10-11H,6-9H2,1-3H3,(H,14,15) |
| InChIKey | CNQBABLURIQXNU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole?
The IUPAC name of 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole (CID 10219888) is 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole.
What is the SMILES notation for 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole?
The canonical SMILES for 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole is CC(C)(C)CCC#CCCc1cnc[nH]1.
What is the InChIKey of 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole?
The InChIKey is CNQBABLURIQXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-13(2,3)9-7-5-4-6-8-12-10-14-11-15-12/h10-11H,6-9H2,1-3H3,(H,14,15).
What are the key properties of 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole?
5-(7,7-dimethyloct-3-ynyl)-1H-imidazole has a molecular weight of 204.32 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7,7-dimethyloct-3-ynyl)-1H-imidazole is sourced from PubChem (CID 10219888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).