C14H14O6 — CID 102199128
(1R,10R,11S,15S)-4,6-dihydroxy-15-methyl-9,14,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-trien-13-one (PubChem CID 102199128) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is (1R,10R,11S,15S)-4,6-dihydroxy-15-methyl-9,14,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-trien-13-one.
| Compound Name | (1R,10R,11S,15S)-4,6-dihydroxy-15-methyl-9,14,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-trien-13-one |
|---|---|
| PubChem CID | 102199128 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (1R,10R,11S,15S)-4,6-dihydroxy-15-methyl-9,14,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-trien-13-one |
| SMILES | C[C@]12OC(=O)C[C@H]1[C@H]1Oc3cc(O)cc(O)c3C[C@H]1O2 |
| InChI | InChI=1S/C14H14O6/c1-14-8(5-12(17)20-14)13-11(19-14)4-7-9(16)2-6(15)3-10(7)18-13/h2-3,8,11,13,15-16H,4-5H2,1H3/t8-,11+,13+,14-/m0/s1 |
| InChIKey | RPJZMAOHFUQPNM-RHBIEUIISA-N |
| XLogP | 1.08 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |