About 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one
5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one (PubChem CID 102199130) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 102199130 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one |
| SMILES | Cc1cc(-c2c(C(C)(C)C)[nH][nH]c2=O)cc(O)c1O |
| InChI | InChI=1S/C14H18N2O3/c1-7-5-8(6-9(17)11(7)18)10-12(14(2,3)4)15-16-13(10)19/h5-6,17-18H,1-4H3,(H2,15,16,19) |
| InChIKey | FHWCECAMALPEIE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one (CID 102199130) is 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one is Cc1cc(-c2c(C(C)(C)C)[nH][nH]c2=O)cc(O)c1O.
What is the InChIKey of 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one?
The InChIKey is FHWCECAMALPEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-7-5-8(6-9(17)11(7)18)10-12(14(2,3)4)15-16-13(10)19/h5-6,17-18H,1-4H3,(H2,15,16,19).
What are the key properties of 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one?
5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one has a molecular weight of 262.31 g/mol, XLogP of 2.39, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-4-(3,4-dihydroxy-5-methylphenyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 102199130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).