C21H30O7 — CID 102199399
methyl 2-[(3R,4R,5Z)-5-[(E)-4-hydroperoxy-4-methylpent-2-enylidene]-2-oxo-3-(6-oxohept-1-en-2-yl)oxan-4-yl]acetate (PubChem CID 102199399) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is methyl 2-[(3R,4R,5Z)-5-[(E)-4-hydroperoxy-4-methylpent-2-enylidene]-2-oxo-3-(6-oxohept-1-en-2-yl)oxan-4-yl]acetate.
| Compound Name | methyl 2-[(3R,4R,5Z)-5-[(E)-4-hydroperoxy-4-methylpent-2-enylidene]-2-oxo-3-(6-oxohept-1-en-2-yl)oxan-4-yl]acetate |
|---|---|
| PubChem CID | 102199399 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl 2-[(3R,4R,5Z)-5-[(E)-4-hydroperoxy-4-methylpent-2-enylidene]-2-oxo-3-(6-oxohept-1-en-2-yl)oxan-4-yl]acetate |
| SMILES | C=C(CCCC(C)=O)[C@@H]1C(=O)OC/C(=C\C=C\C(C)(C)OO)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C21H30O7/c1-14(8-6-9-15(2)22)19-17(12-18(23)26-5)16(13-27-20(19)24)10-7-11-21(3,4)28-25/h7,10-11,17,19,25H,1,6,8-9,12-13H2,2-5H3/b11-7+,16-10+/t17-,19-/m0/s1 |
| InChIKey | DFLACMQIXGYYKQ-JZGAMJCJSA-N |
| XLogP | 3.40 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|