C16H20ClNO — CID 102199591
(4R,11bS)-9-chloro-4-propyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one (PubChem CID 102199591) has the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. Its IUPAC name is (4R,11bS)-9-chloro-4-propyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one.
| Compound Name | (4R,11bS)-9-chloro-4-propyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 102199591 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (4R,11bS)-9-chloro-4-propyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-one |
| SMILES | CCC[C@@H]1CC(=O)C[C@H]2c3ccc(Cl)cc3CCN12 |
| InChI | InChI=1S/C16H20ClNO/c1-2-3-13-9-14(19)10-16-15-5-4-12(17)8-11(15)6-7-18(13)16/h4-5,8,13,16H,2-3,6-7,9-10H2,1H3/t13-,16+/m1/s1 |
| InChIKey | IIIYGEIHFXBCAE-CJNGLKHVSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |