C16H9ClF4O2 — CID 102199778
(E)-1-(4-chlorophenyl)-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 102199778) has the molecular formula C16H9ClF4O2 and a molecular weight of 344.69 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102199778 |
| Molecular Formula | C16H9ClF4O2 |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(2,3,5,6-tetrafluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1c(F)c(F)c(/C=C/C(=O)c2ccc(Cl)cc2)c(F)c1F |
| InChI | InChI=1S/C16H9ClF4O2/c1-23-16-14(20)12(18)10(13(19)15(16)21)6-7-11(22)8-2-4-9(17)5-3-8/h2-7H,1H3/b7-6+ |
| InChIKey | PSGBIQRKRTYWLT-VOTSOKGWSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|