About CID 102199833
CID 102199833 (PubChem CID 102199833) has the molecular formula C34H24N5O6P3
and a molecular weight of 691.52 g/mol.
Molecular Properties
| Compound Name | CID 102199833 |
| PubChem CID | 102199833 |
| Molecular Formula | C34H24N5O6P3 |
| Molecular Weight | 691.52 g/mol |
| Exact Mass | 691.09 |
| IUPAC Name | — |
| SMILES | c1cncc(OP2(Oc3cccnc3)=NP3(=NP4(=N2)Oc2ccccc2-c2ccccc2O4)Oc2ccccc2-c2ccccc2O3)c1 |
| InChI | InChI=1S/C34H24N5O6P3/c1-5-17-31-27(13-1)28-14-2-6-18-32(28)43-47(42-31)37-46(40-25-11-9-21-35-23-25,41-26-12-10-22-36-24-26)38-48(39-47)44-33-19-7-3-15-29(33)30-16-4-8-20-34(30)45-48/h1-24H |
| InChIKey | IKUUMAHBLBPXTD-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 118.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 691.52 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102199833 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102199833?
The IUPAC name of CID 102199833 (CID 102199833) is not available.
What is the SMILES notation for CID 102199833?
The canonical SMILES for CID 102199833 is c1cncc(OP2(Oc3cccnc3)=NP3(=NP4(=N2)Oc2ccccc2-c2ccccc2O4)Oc2ccccc2-c2ccccc2O3)c1.
What is the InChIKey of CID 102199833?
The InChIKey is IKUUMAHBLBPXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H24N5O6P3/c1-5-17-31-27(13-1)28-14-2-6-18-32(28)43-47(42-31)37-46(40-25-11-9-21-35-23-25,41-26-12-10-22-36-24-26)38-48(39-47)44-33-19-7-3-15-29(33)30-16-4-8-20-34(30)45-48/h1-24H.
What are the key properties of CID 102199833?
CID 102199833 has a molecular weight of 691.52 g/mol, XLogP of 11.06, 4 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102199833 is sourced from PubChem (CID 102199833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).