C18H22O6 — CID 102200072
tert-butyl (1S,5S,6S,7S)-5',8-dioxospiro[11-oxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate (PubChem CID 102200072) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is tert-butyl (1S,5S,6S,7S)-5',8-dioxospiro[11-oxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate.
| Compound Name | tert-butyl (1S,5S,6S,7S)-5',8-dioxospiro[11-oxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate |
|---|---|
| PubChem CID | 102200072 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | tert-butyl (1S,5S,6S,7S)-5',8-dioxospiro[11-oxatricyclo[5.3.1.01,5]undecane-6,2'-furan]-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12O[C@@]3(CCC[C@@H]3[C@@]13C=CC(=O)O3)CCC2=O |
| InChI | InChI=1S/C18H22O6/c1-15(2,3)23-14(21)18-12(19)6-9-16(24-18)8-4-5-11(16)17(18)10-7-13(20)22-17/h7,10-11H,4-6,8-9H2,1-3H3/t11-,16-,17-,18-/m0/s1 |
| InChIKey | FFMGUTOXCSWMCF-VMCJVTOISA-N |
| XLogP | 1.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|