C20H26O6 — CID 102200073
tert-butyl (1S,6R,7S,8S)-3'-methyl-5',9-dioxospiro[12-oxatricyclo[6.3.1.01,6]dodecane-7,2'-furan]-8-carboxylate (PubChem CID 102200073) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is tert-butyl (1S,6R,7S,8S)-3'-methyl-5',9-dioxospiro[12-oxatricyclo[6.3.1.01,6]dodecane-7,2'-furan]-8-carboxylate.
| Compound Name | tert-butyl (1S,6R,7S,8S)-3'-methyl-5',9-dioxospiro[12-oxatricyclo[6.3.1.01,6]dodecane-7,2'-furan]-8-carboxylate |
|---|---|
| PubChem CID | 102200073 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl (1S,6R,7S,8S)-3'-methyl-5',9-dioxospiro[12-oxatricyclo[6.3.1.01,6]dodecane-7,2'-furan]-8-carboxylate |
| SMILES | CC1=CC(=O)O[C@@]12[C@@H]1CCCC[C@]13CCC(=O)[C@@]2(C(=O)OC(C)(C)C)O3 |
| InChI | InChI=1S/C20H26O6/c1-12-11-15(22)24-19(12)13-7-5-6-9-18(13)10-8-14(21)20(19,26-18)16(23)25-17(2,3)4/h11,13H,5-10H2,1-4H3/t13-,18+,19-,20+/m1/s1 |
| InChIKey | ITBHXXPPHIIBIS-RHMWYWNKSA-N |
| XLogP | 2.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|