C18H24O6 — CID 102200081
tert-butyl (1S,5S,7S)-3',4',5-trimethyl-2,5'-dioxospiro[8-oxabicyclo[3.2.1]octane-7,2'-furan]-1-carboxylate (PubChem CID 102200081) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is tert-butyl (1S,5S,7S)-3',4',5-trimethyl-2,5'-dioxospiro[8-oxabicyclo[3.2.1]octane-7,2'-furan]-1-carboxylate.
| Compound Name | tert-butyl (1S,5S,7S)-3',4',5-trimethyl-2,5'-dioxospiro[8-oxabicyclo[3.2.1]octane-7,2'-furan]-1-carboxylate |
|---|---|
| PubChem CID | 102200081 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | tert-butyl (1S,5S,7S)-3',4',5-trimethyl-2,5'-dioxospiro[8-oxabicyclo[3.2.1]octane-7,2'-furan]-1-carboxylate |
| SMILES | CC1=C(C)[C@]2(C[C@]3(C)CCC(=O)[C@@]2(C(=O)OC(C)(C)C)O3)OC1=O |
| InChI | InChI=1S/C18H24O6/c1-10-11(2)17(22-13(10)20)9-16(6)8-7-12(19)18(17,24-16)14(21)23-15(3,4)5/h7-9H2,1-6H3/t16-,17-,18-/m0/s1 |
| InChIKey | KWVPJBNEDMOHNE-BZSNNMDCSA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|