About (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine
(2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine (PubChem CID 10220009) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine |
| PubChem CID | 10220009 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine |
| SMILES | C[C@@H](N)Cn1c2c(c3ccccc31)CCC2 |
| InChI | InChI=1S/C14H18N2/c1-10(15)9-16-13-7-3-2-5-11(13)12-6-4-8-14(12)16/h2-3,5,7,10H,4,6,8-9,15H2,1H3/t10-/m1/s1 |
| InChIKey | LUKIRABZVWKFRD-SNVBAGLBSA-N |
| XLogP | 2.48 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine?
The IUPAC name of (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine (CID 10220009) is (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine.
What is the SMILES notation for (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine?
The canonical SMILES for (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine is C[C@@H](N)Cn1c2c(c3ccccc31)CCC2.
What is the InChIKey of (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine?
The InChIKey is LUKIRABZVWKFRD-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H18N2/c1-10(15)9-16-13-7-3-2-5-11(13)12-6-4-8-14(12)16/h2-3,5,7,10H,4,6,8-9,15H2,1H3/t10-/m1/s1.
What are the key properties of (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine?
(2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine has a molecular weight of 214.31 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(2,3-dihydro-1H-cyclopenta[b]indol-4-yl)propan-2-amine is sourced from PubChem (CID 10220009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).