About (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol
(5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol (PubChem CID 102200295) has the molecular formula C13H20OSi
and a molecular weight of 220.39 g/mol. Its IUPAC name is (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol.
Molecular Properties
| Compound Name | (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol |
| PubChem CID | 102200295 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol |
| SMILES | C=C(C)C#C[C@H](O)CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C13H20OSi/c1-12(2)9-10-13(14)8-6-7-11-15(3,4)5/h13-14H,1,6,8H2,2-5H3/t13-/m1/s1 |
| InChIKey | ZMDRHGBIFGYWBT-CYBMUJFWSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol?
The IUPAC name of (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol (CID 102200295) is (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol.
What is the SMILES notation for (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol?
The canonical SMILES for (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol is C=C(C)C#C[C@H](O)CCC#C[Si](C)(C)C.
What is the InChIKey of (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol?
The InChIKey is ZMDRHGBIFGYWBT-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H20OSi/c1-12(2)9-10-13(14)8-6-7-11-15(3,4)5/h13-14H,1,6,8H2,2-5H3/t13-/m1/s1.
What are the key properties of (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol?
(5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol has a molecular weight of 220.39 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-methyl-9-trimethylsilylnon-1-en-3,8-diyn-5-ol is sourced from PubChem (CID 102200295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).