About 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine
3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine (PubChem CID 10220074) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine |
| PubChem CID | 10220074 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C12H17N3O/c1-15(2)8-5-9-16-12-10-6-3-4-7-11(10)13-14-12/h3-4,6-7H,5,8-9H2,1-2H3,(H,13,14) |
| InChIKey | GNRCKJSAOVNGOD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine (CID 10220074) is 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine is CN(C)CCCOc1n[nH]c2ccccc12.
What is the InChIKey of 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine?
The InChIKey is GNRCKJSAOVNGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-15(2)8-5-9-16-12-10-6-3-4-7-11(10)13-14-12/h3-4,6-7H,5,8-9H2,1-2H3,(H,13,14).
What are the key properties of 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine?
3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine has a molecular weight of 219.29 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indazol-3-yloxy)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 10220074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).