C50H52N4O2S4 — CID 102201181
(E)-2-cyano-3-[4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102201181) has the molecular formula C50H52N4O2S4 and a molecular weight of 869.26 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102201181 |
| Molecular Formula | C50H52N4O2S4 |
| Molecular Weight | 869.26 g/mol |
| Exact Mass | 868.30 |
| IUPAC Name | (E)-2-cyano-3-[4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCc1cc(/C=C(\C#N)C(=O)O)sc1-c1nc2sc(-c3sc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3CCCCCCCC)nc2s1 |
| InChI | InChI=1S/C50H52N4O2S4/c1-3-5-7-9-11-15-21-36-31-42(32-38(34-51)50(55)56)57-44(36)46-52-48-49(59-46)53-47(60-48)45-37(22-16-12-10-8-6-4-2)33-43(58-45)35-27-29-41(30-28-35)54(39-23-17-13-18-24-39)40-25-19-14-20-26-40/h13-14,17-20,23-33H,3-12,15-16,21-22H2,1-2H3,(H,55,56)/b38-32+ |
| InChIKey | JTMMGGIAJDNMCG-WAQNPYFYSA-N |
| XLogP | 16.14 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.26 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|