About (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one
(6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one (PubChem CID 10220155) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one.
Molecular Properties
| Compound Name | (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one |
| PubChem CID | 10220155 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one |
| SMILES | O=C1/C(=C\c2cnc[nH]2)CCc2ncccc21 |
| InChI | InChI=1S/C13H11N3O/c17-13-9(6-10-7-14-8-16-10)3-4-12-11(13)2-1-5-15-12/h1-2,5-8H,3-4H2,(H,14,16)/b9-6- |
| InChIKey | MYMDFSCQVUQRNA-TWGQIWQCSA-N |
| XLogP | 2.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one?
The IUPAC name of (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one (CID 10220155) is (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one.
What is the SMILES notation for (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one?
The canonical SMILES for (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one is O=C1/C(=C\c2cnc[nH]2)CCc2ncccc21.
What is the InChIKey of (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one?
The InChIKey is MYMDFSCQVUQRNA-TWGQIWQCSA-N. The full InChI is InChI=1S/C13H11N3O/c17-13-9(6-10-7-14-8-16-10)3-4-12-11(13)2-1-5-15-12/h1-2,5-8H,3-4H2,(H,14,16)/b9-6-.
What are the key properties of (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one?
(6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one has a molecular weight of 225.25 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-(1H-imidazol-5-ylmethylidene)-7,8-dihydroquinolin-5-one is sourced from PubChem (CID 10220155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).