C19H16FNO4 — CID 102201806
methyl 2-(1,3-dioxoisoindol-2-yl)-4-fluoro-4-phenylbutanoate (PubChem CID 102201806) has the molecular formula C19H16FNO4 and a molecular weight of 341.34 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-4-fluoro-4-phenylbutanoate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-4-fluoro-4-phenylbutanoate |
|---|---|
| PubChem CID | 102201806 |
| Molecular Formula | C19H16FNO4 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-4-fluoro-4-phenylbutanoate |
| SMILES | COC(=O)C(CC(F)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16FNO4/c1-25-19(24)16(11-15(20)12-7-3-2-4-8-12)21-17(22)13-9-5-6-10-14(13)18(21)23/h2-10,15-16H,11H2,1H3 |
| InChIKey | SILXNVRVTFUMES-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|