About 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione
6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione (PubChem CID 102201890) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione |
| PubChem CID | 102201890 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione |
| SMILES | COCC1(C)CC(=O)C=C(C)C1=O |
| InChI | InChI=1S/C10H14O3/c1-7-4-8(11)5-10(2,6-13-3)9(7)12/h4H,5-6H2,1-3H3 |
| InChIKey | QEPKQUHSJRSTRC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione?
The IUPAC name of 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione (CID 102201890) is 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione.
What is the SMILES notation for 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione?
The canonical SMILES for 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione is COCC1(C)CC(=O)C=C(C)C1=O.
What is the InChIKey of 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione?
The InChIKey is QEPKQUHSJRSTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-7-4-8(11)5-10(2,6-13-3)9(7)12/h4H,5-6H2,1-3H3.
What are the key properties of 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione?
6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione has a molecular weight of 182.22 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethyl)-2,6-dimethylcyclohex-2-ene-1,4-dione is sourced from PubChem (CID 102201890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).