About 4-decyl-1,3-oxazolidin-2-one
4-decyl-1,3-oxazolidin-2-one (PubChem CID 10220190) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-decyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-decyl-1,3-oxazolidin-2-one |
| PubChem CID | 10220190 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 4-decyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCCC1COC(=O)N1 |
| InChI | InChI=1S/C13H25NO2/c1-2-3-4-5-6-7-8-9-10-12-11-16-13(15)14-12/h12H,2-11H2,1H3,(H,14,15) |
| InChIKey | IUWVYVOQTFVXKL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decyl-1,3-oxazolidin-2-one?
The IUPAC name of 4-decyl-1,3-oxazolidin-2-one (CID 10220190) is 4-decyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-decyl-1,3-oxazolidin-2-one?
The canonical SMILES for 4-decyl-1,3-oxazolidin-2-one is CCCCCCCCCCC1COC(=O)N1.
What is the InChIKey of 4-decyl-1,3-oxazolidin-2-one?
The InChIKey is IUWVYVOQTFVXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-2-3-4-5-6-7-8-9-10-12-11-16-13(15)14-12/h12H,2-11H2,1H3,(H,14,15).
What are the key properties of 4-decyl-1,3-oxazolidin-2-one?
4-decyl-1,3-oxazolidin-2-one has a molecular weight of 227.35 g/mol, XLogP of 3.63, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 10220190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).