About 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole
1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole (PubChem CID 102201943) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole.
Molecular Properties
| Compound Name | 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole |
| PubChem CID | 102201943 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole |
| SMILES | C=Cc1c(CC(OCC)OCC)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C17H23N3O2/c1-4-16-15(12-17(21-5-2)22-6-3)18-19-20(16)13-14-10-8-7-9-11-14/h4,7-11,17H,1,5-6,12-13H2,2-3H3 |
| InChIKey | LKBXOUDHHSSUEU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole?
The IUPAC name of 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole (CID 102201943) is 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole.
What is the SMILES notation for 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole?
The canonical SMILES for 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole is C=Cc1c(CC(OCC)OCC)nnn1Cc1ccccc1.
What is the InChIKey of 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole?
The InChIKey is LKBXOUDHHSSUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2/c1-4-16-15(12-17(21-5-2)22-6-3)18-19-20(16)13-14-10-8-7-9-11-14/h4,7-11,17H,1,5-6,12-13H2,2-3H3.
What are the key properties of 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole?
1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole has a molecular weight of 301.39 g/mol, XLogP of 2.91, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(2,2-diethoxyethyl)-5-ethenyltriazole is sourced from PubChem (CID 102201943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).