C29H18O8 — CID 102202263
5-[7-(3,5-dicarboxyphenyl)-9H-fluoren-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 102202263) has the molecular formula C29H18O8 and a molecular weight of 494.46 g/mol. Its IUPAC name is 5-[7-(3,5-dicarboxyphenyl)-9H-fluoren-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[7-(3,5-dicarboxyphenyl)-9H-fluoren-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 102202263 |
| Molecular Formula | C29H18O8 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 5-[7-(3,5-dicarboxyphenyl)-9H-fluoren-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2ccc3c(c2)Cc2cc(-c4cc(C(=O)O)cc(C(=O)O)c4)ccc2-3)c1 |
| InChI | InChI=1S/C29H18O8/c30-26(31)20-7-16(8-21(12-20)27(32)33)14-1-3-24-18(5-14)11-19-6-15(2-4-25(19)24)17-9-22(28(34)35)13-23(10-17)29(36)37/h1-10,12-13H,11H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | SHVNFNRBYJHTDF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |