About 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one
1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 10220227) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one |
| PubChem CID | 10220227 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | Cc1ccc2c(c1)C1(CCCN(C)C1)C(=O)N2 |
| InChI | InChI=1S/C14H18N2O/c1-10-4-5-12-11(8-10)14(13(17)15-12)6-3-7-16(2)9-14/h4-5,8H,3,6-7,9H2,1-2H3,(H,15,17) |
| InChIKey | YZPDIZZSESEWLS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one?
The IUPAC name of 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one (CID 10220227) is 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one.
What is the SMILES notation for 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one?
The canonical SMILES for 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one is Cc1ccc2c(c1)C1(CCCN(C)C1)C(=O)N2.
What is the InChIKey of 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one?
The InChIKey is YZPDIZZSESEWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-10-4-5-12-11(8-10)14(13(17)15-12)6-3-7-16(2)9-14/h4-5,8H,3,6-7,9H2,1-2H3,(H,15,17).
What are the key properties of 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one?
1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one has a molecular weight of 230.31 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1',5-dimethylspiro[1H-indole-3,3'-piperidine]-2-one is sourced from PubChem (CID 10220227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).